C22H33NO — CID 3906383
N,2-bis(1-adamantyl)acetamide (PubChem CID 3906383) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is N,2-bis(1-adamantyl)acetamide.
| Compound Name | N,2-bis(1-adamantyl)acetamide |
|---|---|
| PubChem CID | 3906383 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N,2-bis(1-adamantyl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H33NO/c24-20(13-21-7-14-1-15(8-21)3-16(2-14)9-21)23-22-10-17-4-18(11-22)6-19(5-17)12-22/h14-19H,1-13H2,(H,23,24) |
| InChIKey | BRRPODXVMIZFMU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |