C17H14ClN3O4S — CID 3907063
N-(5-chloro-2-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3907063) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3907063 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccccc1-c1nnc(SCC(=O)Nc2cc(Cl)ccc2O)o1 |
| InChI | InChI=1S/C17H14ClN3O4S/c1-24-14-5-3-2-4-11(14)16-20-21-17(25-16)26-9-15(23)19-12-8-10(18)6-7-13(12)22/h2-8,22H,9H2,1H3,(H,19,23) |
| InChIKey | IDZCTQHVJBNOBM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|