About 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one
1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 39073052) has the molecular formula C17H24N4OS
and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one.
Molecular Properties
| Compound Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one |
| PubChem CID | 39073052 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | CCc1cc2c(N3CCN(C(=O)CC(C)C)CC3)ncnc2s1 |
| InChI | InChI=1S/C17H24N4OS/c1-4-13-10-14-16(18-11-19-17(14)23-13)21-7-5-20(6-8-21)15(22)9-12(2)3/h10-12H,4-9H2,1-3H3 |
| InChIKey | VXYVSOPLZPNDLE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one?
The IUPAC name of 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one (CID 39073052) is 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one.
What is the SMILES notation for 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one?
The canonical SMILES for 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one is CCc1cc2c(N3CCN(C(=O)CC(C)C)CC3)ncnc2s1.
What is the InChIKey of 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one?
The InChIKey is VXYVSOPLZPNDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4OS/c1-4-13-10-14-16(18-11-19-17(14)23-13)21-7-5-20(6-8-21)15(22)9-12(2)3/h10-12H,4-9H2,1-3H3.
What are the key properties of 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one?
1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one has a molecular weight of 332.47 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-methylbutan-1-one is sourced from PubChem (CID 39073052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).