C28H30N2O4S — CID 39080342
2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylsulfonyl]-N-phenylacetamide (PubChem CID 39080342) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylsulfonyl]-N-phenylacetamide.
| Compound Name | 2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylsulfonyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 39080342 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[[4-(4-benzylpiperidine-1-carbonyl)phenyl]methylsulfonyl]-N-phenylacetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccc(C(=O)N2CCC(Cc3ccccc3)CC2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C28H30N2O4S/c31-27(29-26-9-5-2-6-10-26)21-35(33,34)20-24-11-13-25(14-12-24)28(32)30-17-15-23(16-18-30)19-22-7-3-1-4-8-22/h1-14,23H,15-21H2,(H,29,31) |
| InChIKey | BHORDBCDNFYCCC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |