About 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene
3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene (PubChem CID 39083054) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene.
Molecular Properties
| Compound Name | 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
| PubChem CID | 39083054 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
| SMILES | c1cc(C2=NOC3(CCNCC3)C2)ccn1 |
| InChI | InChI=1S/C12H15N3O/c1-5-13-6-2-10(1)11-9-12(16-15-11)3-7-14-8-4-12/h1-2,5-6,14H,3-4,7-9H2 |
| InChIKey | HLFVADAWUOIQGN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene?
The IUPAC name of 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene (CID 39083054) is 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene.
What is the SMILES notation for 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene?
The canonical SMILES for 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is c1cc(C2=NOC3(CCNCC3)C2)ccn1.
What is the InChIKey of 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene?
The InChIKey is HLFVADAWUOIQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-5-13-6-2-10(1)11-9-12(16-15-11)3-7-14-8-4-12/h1-2,5-6,14H,3-4,7-9H2.
What are the key properties of 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene?
3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene has a molecular weight of 217.27 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-yl-1-oxa-2,8-diazaspiro[4.5]dec-2-ene is sourced from PubChem (CID 39083054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).