About 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 39084569) has the molecular formula C15H18ClN3OS
and a molecular weight of 323.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide |
| PubChem CID | 39084569 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)CCNC(=O)Cc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-19(2)8-7-17-14(20)9-13-10-21-15(18-13)11-3-5-12(16)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,17,20) |
| InChIKey | VSVHTIRANYQLBO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide?
The IUPAC name of 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide (CID 39084569) is 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide.
What is the SMILES notation for 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide?
The canonical SMILES for 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide is CN(C)CCNC(=O)Cc1csc(-c2ccc(Cl)cc2)n1.
What is the InChIKey of 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide?
The InChIKey is VSVHTIRANYQLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3OS/c1-19(2)8-7-17-14(20)9-13-10-21-15(18-13)11-3-5-12(16)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,17,20).
What are the key properties of 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide?
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide has a molecular weight of 323.85 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-[2-(dimethylamino)ethyl]acetamide is sourced from PubChem (CID 39084569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).