C19H24N4OS — CID 39084732
N-[4-(dimethylamino)butyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 39084732) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)butyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 39084732 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCN(C)C)sc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C19H24N4OS/c1-14-17(18(24)20-11-7-8-12-22(2)3)25-19-21-16(13-23(14)19)15-9-5-4-6-10-15/h4-6,9-10,13H,7-8,11-12H2,1-3H3,(H,20,24) |
| InChIKey | WHSCZSLPVNXADT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|