C7H4N6Se — CID 3908602
4-(tetrazol-1-yl)-2,1,3-benzoselenadiazole (PubChem CID 3908602) has the molecular formula C7H4N6Se and a molecular weight of 251.11 g/mol. Its IUPAC name is 4-(tetrazol-1-yl)-2,1,3-benzoselenadiazole.
| Compound Name | 4-(tetrazol-1-yl)-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 3908602 |
| Molecular Formula | C7H4N6Se |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 4-(tetrazol-1-yl)-2,1,3-benzoselenadiazole |
| SMILES | c1cc(-n2cnnn2)c2n[se]nc2c1 |
| InChI | InChI=1S/C7H4N6Se/c1-2-5-7(10-14-9-5)6(3-1)13-4-8-11-12-13/h1-4H |
| InChIKey | JXGXBYFEZRATSG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|