C23H21FN4O3S — CID 39088716
N-[4-(1H-benzimidazol-2-yl)phenyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 39088716) has the molecular formula C23H21FN4O3S and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[4-(1H-benzimidazol-2-yl)phenyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 39088716 |
| Molecular Formula | C23H21FN4O3S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[4-(1H-benzimidazol-2-yl)phenyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(-c3nc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C23H21FN4O3S/c1-14(2)28-32(30,31)17-11-12-19(24)18(13-17)23(29)25-16-9-7-15(8-10-16)22-26-20-5-3-4-6-21(20)27-22/h3-14,28H,1-2H3,(H,25,29)(H,26,27) |
| InChIKey | XLNYRGQAMDIVKH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |