C17H15Cl2N3O5 — CID 39093599
N-(3,4-dichlorophenyl)-2-[methyl-[2-(3-nitrophenoxy)acetyl]amino]acetamide (PubChem CID 39093599) has the molecular formula C17H15Cl2N3O5 and a molecular weight of 412.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[methyl-[2-(3-nitrophenoxy)acetyl]amino]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[methyl-[2-(3-nitrophenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 39093599 |
| Molecular Formula | C17H15Cl2N3O5 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[methyl-[2-(3-nitrophenoxy)acetyl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15Cl2N3O5/c1-21(9-16(23)20-11-5-6-14(18)15(19)7-11)17(24)10-27-13-4-2-3-12(8-13)22(25)26/h2-8H,9-10H2,1H3,(H,20,23) |
| InChIKey | ATJXQMOJMCZXTK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|