C14H17Cl2N3 — CID 39095770
[1-tert-butyl-3-(3,4-dichlorophenyl)pyrazol-4-yl]methanamine (PubChem CID 39095770) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is [1-tert-butyl-3-(3,4-dichlorophenyl)pyrazol-4-yl]methanamine.
| Compound Name | [1-tert-butyl-3-(3,4-dichlorophenyl)pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 39095770 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [1-tert-butyl-3-(3,4-dichlorophenyl)pyrazol-4-yl]methanamine |
| SMILES | CC(C)(C)n1cc(CN)c(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H17Cl2N3/c1-14(2,3)19-8-10(7-17)13(18-19)9-4-5-11(15)12(16)6-9/h4-6,8H,7,17H2,1-3H3 |
| InChIKey | MNZWDACYTGDUMB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |