C13H15N3S — CID 39096372
3-(3,4-dimethylphenyl)-1-methylpyrazole-4-carbothioamide (PubChem CID 39096372) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-methylpyrazole-4-carbothioamide.
| Compound Name | 3-(3,4-dimethylphenyl)-1-methylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 39096372 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-methylpyrazole-4-carbothioamide |
| SMILES | Cc1ccc(-c2nn(C)cc2C(N)=S)cc1C |
| InChI | InChI=1S/C13H15N3S/c1-8-4-5-10(6-9(8)2)12-11(13(14)17)7-16(3)15-12/h4-7H,1-3H3,(H2,14,17) |
| InChIKey | KKBXGFKBTFFOLO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|