C11H13NOS — CID 39097873
2-(5,7-dimethyl-1,2-benzoxazol-3-yl)ethanethiol (PubChem CID 39097873) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(5,7-dimethyl-1,2-benzoxazol-3-yl)ethanethiol.
| Compound Name | 2-(5,7-dimethyl-1,2-benzoxazol-3-yl)ethanethiol |
|---|---|
| PubChem CID | 39097873 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(5,7-dimethyl-1,2-benzoxazol-3-yl)ethanethiol |
| SMILES | Cc1cc(C)c2onc(CCS)c2c1 |
| InChI | InChI=1S/C11H13NOS/c1-7-5-8(2)11-9(6-7)10(3-4-14)12-13-11/h5-6,14H,3-4H2,1-2H3 |
| InChIKey | NTEYLRJTVATRLN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|