About (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine
(6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine (PubChem CID 39106445) has the molecular formula C9H9BrN2S
and a molecular weight of 257.16 g/mol. Its IUPAC name is (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine |
| PubChem CID | 39106445 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine |
| SMILES | Cc1cc2nc(CN)sc2cc1Br |
| InChI | InChI=1S/C9H9BrN2S/c1-5-2-7-8(3-6(5)10)13-9(4-11)12-7/h2-3H,4,11H2,1H3 |
| InChIKey | INZJHSBTMVXOST-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine?
The IUPAC name of (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine (CID 39106445) is (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine.
What is the SMILES notation for (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine?
The canonical SMILES for (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine is Cc1cc2nc(CN)sc2cc1Br.
What is the InChIKey of (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine?
The InChIKey is INZJHSBTMVXOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2S/c1-5-2-7-8(3-6(5)10)13-9(4-11)12-7/h2-3H,4,11H2,1H3.
What are the key properties of (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine?
(6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine has a molecular weight of 257.16 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-5-methyl-1,3-benzothiazol-2-yl)methanamine is sourced from PubChem (CID 39106445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).