C19H32N4O — CID 39112746
3-(3-amino-4-pyrrolidin-1-ylphenyl)-N-[4-(dimethylamino)butyl]propanamide (PubChem CID 39112746) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is 3-(3-amino-4-pyrrolidin-1-ylphenyl)-N-[4-(dimethylamino)butyl]propanamide.
| Compound Name | 3-(3-amino-4-pyrrolidin-1-ylphenyl)-N-[4-(dimethylamino)butyl]propanamide |
|---|---|
| PubChem CID | 39112746 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 3-(3-amino-4-pyrrolidin-1-ylphenyl)-N-[4-(dimethylamino)butyl]propanamide |
| SMILES | CN(C)CCCCNC(=O)CCc1ccc(N2CCCC2)c(N)c1 |
| InChI | InChI=1S/C19H32N4O/c1-22(2)12-4-3-11-21-19(24)10-8-16-7-9-18(17(20)15-16)23-13-5-6-14-23/h7,9,15H,3-6,8,10-14,20H2,1-2H3,(H,21,24) |
| InChIKey | HQNVHZXQSJXHTC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|