About [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate
[3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate (PubChem CID 39115129) has the molecular formula C22H16N2O3
and a molecular weight of 356.38 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate |
| PubChem CID | 39115129 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate |
| SMILES | COc1ccccc1/C(C#N)=C\c1cccc(OC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C22H16N2O3/c1-26-21-8-3-2-7-20(21)18(15-23)13-16-5-4-6-19(14-16)27-22(25)17-9-11-24-12-10-17/h2-14H,1H3/b18-13- |
| InChIKey | JZZIBMIDBHSXCN-AQTBWJFISA-N |
| XLogP | 4.37 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate?
The IUPAC name of [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate (CID 39115129) is [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate.
What is the SMILES notation for [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate?
The canonical SMILES for [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate is COc1ccccc1/C(C#N)=C\c1cccc(OC(=O)c2ccncc2)c1.
What is the InChIKey of [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate?
The InChIKey is JZZIBMIDBHSXCN-AQTBWJFISA-N. The full InChI is InChI=1S/C22H16N2O3/c1-26-21-8-3-2-7-20(21)18(15-23)13-16-5-4-6-19(14-16)27-22(25)17-9-11-24-12-10-17/h2-14H,1H3/b18-13-.
What are the key properties of [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate?
[3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate has a molecular weight of 356.38 g/mol, XLogP of 4.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-2-cyano-2-(2-methoxyphenyl)ethenyl]phenyl] pyridine-4-carboxylate is sourced from PubChem (CID 39115129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).