C25H31N3O2 — CID 39115804
1-[(2S)-2-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 39115804) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 39115804 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[(2S)-2-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@H]1c1nc2ccccc2n1CCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-18(29)27-15-7-10-23(27)24-26-21-8-5-6-9-22(21)28(24)16-17-30-20-13-11-19(12-14-20)25(2,3)4/h5-6,8-9,11-14,23H,7,10,15-17H2,1-4H3/t23-/m0/s1 |
| InChIKey | GAHSKGQNNPHRIX-QHCPKHFHSA-N |
| XLogP | 5.10 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |