C24H27N5O4S — CID 3911590
2-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 3911590) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3911590 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(CC(=O)Nc2ccc(OC)cc2)nnc1SCC(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c1-4-14-29-21(15-22(30)25-17-6-10-19(32-3)11-7-17)27-28-24(29)34-16-23(31)26-18-8-12-20(13-9-18)33-5-2/h4,6-13H,1,5,14-16H2,2-3H3,(H,25,30)(H,26,31) |
| InChIKey | QQZIIBSAXLYWTF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|