C25H30N2O5S — CID 3911798
2-[benzylsulfonyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide (PubChem CID 3911798) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[benzylsulfonyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[benzylsulfonyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3911798 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[benzylsulfonyl(2-methoxyethyl)amino]-N-(furan-2-ylmethyl)-N-(2-phenylethyl)acetamide |
| SMILES | COCCN(CC(=O)N(CCc1ccccc1)Cc1ccco1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5S/c1-31-18-16-27(33(29,30)21-23-11-6-3-7-12-23)20-25(28)26(19-24-13-8-17-32-24)15-14-22-9-4-2-5-10-22/h2-13,17H,14-16,18-21H2,1H3 |
| InChIKey | JYJUSIIFNKUQBR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |