About 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate
2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate (PubChem CID 39119884) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate.
Molecular Properties
| Compound Name | 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| PubChem CID | 39119884 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| SMILES | Cc1ccc2nc(CC(=O)[O-])c(C[NH+]3CCCCC3)n2c1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-5-6-15-17-13(9-16(20)21)14(19(15)10-12)11-18-7-3-2-4-8-18/h5-6,10H,2-4,7-9,11H2,1H3,(H,20,21) |
| InChIKey | YYLAWXJBGWSFOL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The IUPAC name of 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate (CID 39119884) is 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate.
What is the SMILES notation for 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The canonical SMILES for 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate is Cc1ccc2nc(CC(=O)[O-])c(C[NH+]3CCCCC3)n2c1.
What is the InChIKey of 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The InChIKey is YYLAWXJBGWSFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-12-5-6-15-17-13(9-16(20)21)14(19(15)10-12)11-18-7-3-2-4-8-18/h5-6,10H,2-4,7-9,11H2,1H3,(H,20,21).
What are the key properties of 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate has a molecular weight of 287.36 g/mol, XLogP of -0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-methyl-3-(piperidin-1-ium-1-ylmethyl)imidazo[1,2-a]pyridin-2-yl]acetate is sourced from PubChem (CID 39119884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).