C23H26N2O3S — CID 3912196
6,6-dimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7',8'-diol (PubChem CID 3912196) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 6,6-dimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7',8'-diol.
| Compound Name | 6,6-dimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7',8'-diol |
|---|---|
| PubChem CID | 3912196 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 6,6-dimethyl-4'-phenyl-2-prop-2-enylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7',8'-diol |
| SMILES | C=CCSC1=NC2(CC(c3ccccc3)c3ccc(O)c(O)c3O2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H26N2O3S/c1-4-12-29-21-24-22(2,3)14-23(25-21)13-17(15-8-6-5-7-9-15)16-10-11-18(26)19(27)20(16)28-23/h4-11,17,26-27H,1,12-14H2,2-3H3,(H,24,25) |
| InChIKey | IFGKIGVDILAGBM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|