C19H20N2O2 — CID 39125924
[6-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]methanol (PubChem CID 39125924) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is [6-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]methanol.
| Compound Name | [6-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 39125924 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [6-methyl-2-[4-(2-methylprop-2-enoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]methanol |
| SMILES | C=C(C)COc1ccc(-c2nc3ccc(C)cn3c2CO)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-13(2)12-23-16-7-5-15(6-8-16)19-17(11-22)21-10-14(3)4-9-18(21)20-19/h4-10,22H,1,11-12H2,2-3H3 |
| InChIKey | NLDCVFOYDJLJTR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|