C23H25N5O4S2 — CID 3912810
1-(2,5-dimethylphenyl)-3-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]thiourea (PubChem CID 3912810) has the molecular formula C23H25N5O4S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]thiourea |
|---|---|
| PubChem CID | 3912810 |
| Molecular Formula | C23H25N5O4S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]thiourea |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2NNC(=S)Nc2cc(C)ccc2C)c(C)c1 |
| InChI | InChI=1S/C23H25N5O4S2/c1-14-6-9-19(17(4)11-14)27-34(31,32)22-13-18(28(29)30)8-10-20(22)25-26-23(33)24-21-12-15(2)5-7-16(21)3/h5-13,25,27H,1-4H3,(H2,24,26,33) |
| InChIKey | IDHSZTFTRXJXJE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|