C15H25N3O — CID 39131014
3-[3-amino-4-(diethylamino)phenyl]-N,N-dimethylpropanamide (PubChem CID 39131014) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[3-amino-4-(diethylamino)phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[3-amino-4-(diethylamino)phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 39131014 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 3-[3-amino-4-(diethylamino)phenyl]-N,N-dimethylpropanamide |
| SMILES | CCN(CC)c1ccc(CCC(=O)N(C)C)cc1N |
| InChI | InChI=1S/C15H25N3O/c1-5-18(6-2)14-9-7-12(11-13(14)16)8-10-15(19)17(3)4/h7,9,11H,5-6,8,10,16H2,1-4H3 |
| InChIKey | VJWDZJZPHDTOLF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|