C18H19ClN2O4 — CID 39133027
3-chloro-4,5-dimethoxy-N-[2-methyl-5-(methylcarbamoyl)phenyl]benzamide (PubChem CID 39133027) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-[2-methyl-5-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-[2-methyl-5-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 39133027 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-[2-methyl-5-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(C)c(NC(=O)c2cc(Cl)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-10-5-6-11(17(22)20-2)8-14(10)21-18(23)12-7-13(19)16(25-4)15(9-12)24-3/h5-9H,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | SFBRVMAYOPLPHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |