About 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol (PubChem CID 3914135) has the molecular formula C22H27NOS2
and a molecular weight of 385.60 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol |
| PubChem CID | 3914135 |
| Molecular Formula | C22H27NOS2 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CSc2nc3ccccc3s2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27NOS2/c1-21(2,3)15-11-14(12-16(19(15)24)22(4,5)6)13-25-20-23-17-9-7-8-10-18(17)26-20/h7-12,24H,13H2,1-6H3 |
| InChIKey | ZYYUZUSSUOFZMP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol?
The IUPAC name of 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol (CID 3914135) is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol.
What is the SMILES notation for 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol?
The canonical SMILES for 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol is CC(C)(C)c1cc(CSc2nc3ccccc3s2)cc(C(C)(C)C)c1O.
What is the InChIKey of 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol?
The InChIKey is ZYYUZUSSUOFZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NOS2/c1-21(2,3)15-11-14(12-16(19(15)24)22(4,5)6)13-25-20-23-17-9-7-8-10-18(17)26-20/h7-12,24H,13H2,1-6H3.
What are the key properties of 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol?
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol has a molecular weight of 385.60 g/mol, XLogP of 6.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-2,6-ditert-butylphenol is sourced from PubChem (CID 3914135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).