C20H19N3O4S — CID 39142612
N-methyl-2-[(4-methylphenoxy)methyl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 39142612) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-methyl-2-[(4-methylphenoxy)methyl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-2-[(4-methylphenoxy)methyl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 39142612 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-methyl-2-[(4-methylphenoxy)methyl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(OCc2nc(C(=O)N(C)Cc3ccccc3[N+](=O)[O-])cs2)cc1 |
| InChI | InChI=1S/C20H19N3O4S/c1-14-7-9-16(10-8-14)27-12-19-21-17(13-28-19)20(24)22(2)11-15-5-3-4-6-18(15)23(25)26/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | LYUVOSKWGQTXLO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|