About 2-amino-3,4-dihydroxybutanoic acid
2-amino-3,4-dihydroxybutanoic acid (PubChem CID 3914727) has the molecular formula C4H9NO4
and a molecular weight of 135.12 g/mol. Its IUPAC name is 2-amino-3,4-dihydroxybutanoic acid.
Molecular Properties
| Compound Name | 2-amino-3,4-dihydroxybutanoic acid |
| PubChem CID | 3914727 |
| Molecular Formula | C4H9NO4 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 2-amino-3,4-dihydroxybutanoic acid |
| SMILES | NC(C(=O)O)C(O)CO |
| InChI | InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9) |
| InChIKey | JBNUARFQOCGDRK-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3,4-dihydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4-dihydroxybutanoic acid?
The IUPAC name of 2-amino-3,4-dihydroxybutanoic acid (CID 3914727) is 2-amino-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 2-amino-3,4-dihydroxybutanoic acid?
The canonical SMILES for 2-amino-3,4-dihydroxybutanoic acid is NC(C(=O)O)C(O)CO.
What is the InChIKey of 2-amino-3,4-dihydroxybutanoic acid?
The InChIKey is JBNUARFQOCGDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9).
What are the key properties of 2-amino-3,4-dihydroxybutanoic acid?
2-amino-3,4-dihydroxybutanoic acid has a molecular weight of 135.12 g/mol, XLogP of -2.25, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 3914727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).