C18H17N3S — CID 39148095
3-[(2-cyclopropylbenzimidazol-1-yl)methyl]benzenecarbothioamide (PubChem CID 39148095) has the molecular formula C18H17N3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 3-[(2-cyclopropylbenzimidazol-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-[(2-cyclopropylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 39148095 |
| Molecular Formula | C18H17N3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-[(2-cyclopropylbenzimidazol-1-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(Cn2c(C3CC3)nc3ccccc32)c1 |
| InChI | InChI=1S/C18H17N3S/c19-17(22)14-5-3-4-12(10-14)11-21-16-7-2-1-6-15(16)20-18(21)13-8-9-13/h1-7,10,13H,8-9,11H2,(H2,19,22) |
| InChIKey | NNTWVTOBRXPGGK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|