C17H26N2O4 — CID 39150934
6-[[2,2-dimethyl-3-(3-methyl-2-oxo-1-pyridinyl)propanoyl]amino]hexanoic acid (PubChem CID 39150934) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 6-[[2,2-dimethyl-3-(3-methyl-2-oxo-1-pyridinyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-[[2,2-dimethyl-3-(3-methyl-2-oxo-1-pyridinyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 39150934 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-[[2,2-dimethyl-3-(3-methyl-2-oxo-1-pyridinyl)propanoyl]amino]hexanoic acid |
| SMILES | Cc1cccn(CC(C)(C)C(=O)NCCCCCC(=O)O)c1=O |
| InChI | InChI=1S/C17H26N2O4/c1-13-8-7-11-19(15(13)22)12-17(2,3)16(23)18-10-6-4-5-9-14(20)21/h7-8,11H,4-6,9-10,12H2,1-3H3,(H,18,23)(H,20,21) |
| InChIKey | FZBIDVHWLLNOMT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|