C18H20N2O2S — CID 39158645
N-(2-carbamothioylphenyl)-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 39158645) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(2-carbamothioylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 39158645 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2-carbamothioylphenyl)-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccccc2C(N)=S)cc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-12(2)13-7-9-14(10-8-13)22-11-17(21)20-16-6-4-3-5-15(16)18(19)23/h3-10,12H,11H2,1-2H3,(H2,19,23)(H,20,21) |
| InChIKey | RDGCDEOAPWOCQP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|