About (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate
(6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate (PubChem CID 3916170) has the molecular formula C20H15FO5
and a molecular weight of 354.33 g/mol. Its IUPAC name is (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate.
Molecular Properties
| Compound Name | (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate |
| PubChem CID | 3916170 |
| Molecular Formula | C20H15FO5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate |
| SMILES | O=C(OCc1cc(F)cc2c1OC(c1ccccc1)OC2)c1ccco1 |
| InChI | InChI=1S/C20H15FO5/c21-16-9-14(11-24-19(22)17-7-4-8-23-17)18-15(10-16)12-25-20(26-18)13-5-2-1-3-6-13/h1-10,20H,11-12H2 |
| InChIKey | FPCSTOKABRZNDB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate?
The IUPAC name of (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate (CID 3916170) is (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate.
What is the SMILES notation for (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate?
The canonical SMILES for (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate is O=C(OCc1cc(F)cc2c1OC(c1ccccc1)OC2)c1ccco1.
What is the InChIKey of (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate?
The InChIKey is FPCSTOKABRZNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FO5/c21-16-9-14(11-24-19(22)17-7-4-8-23-17)18-15(10-16)12-25-20(26-18)13-5-2-1-3-6-13/h1-10,20H,11-12H2.
What are the key properties of (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate?
(6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate has a molecular weight of 354.33 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2-phenyl-4H-1,3-benzodioxin-8-yl)methyl furan-2-carboxylate is sourced from PubChem (CID 3916170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).