C13H16N4O — CID 39162238
(8-methylimidazo[1,2-a]pyridin-2-yl)-piperazin-1-ylmethanone (PubChem CID 39162238) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is (8-methylimidazo[1,2-a]pyridin-2-yl)-piperazin-1-ylmethanone.
| Compound Name | (8-methylimidazo[1,2-a]pyridin-2-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 39162238 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (8-methylimidazo[1,2-a]pyridin-2-yl)-piperazin-1-ylmethanone |
| SMILES | Cc1cccn2cc(C(=O)N3CCNCC3)nc12 |
| InChI | InChI=1S/C13H16N4O/c1-10-3-2-6-17-9-11(15-12(10)17)13(18)16-7-4-14-5-8-16/h2-3,6,9,14H,4-5,7-8H2,1H3 |
| InChIKey | DGMABEVIVZJLBR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |