C17H19N3O2 — CID 39163292
N-(2-aminoethyl)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenoxy]acetamide (PubChem CID 39163292) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenoxy]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 39163292 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-[(E)-2-pyridin-4-ylethenyl]phenoxy]acetamide |
| SMILES | NCCNC(=O)COc1ccc(/C=C/c2ccncc2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c18-9-12-20-17(21)13-22-16-5-3-14(4-6-16)1-2-15-7-10-19-11-8-15/h1-8,10-11H,9,12-13,18H2,(H,20,21)/b2-1+ |
| InChIKey | IFYSSCLBLYRUHK-OWOJBTEDSA-N |
| XLogP | 1.71 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |