C16H19N3O3S — CID 39165087
6-[(4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carbonyl)amino]hexanoic acid (PubChem CID 39165087) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 6-[(4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 39165087 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 6-[(4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carbonyl)amino]hexanoic acid |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C16H19N3O3S/c1-11-14(15(22)18-10-5-2-3-8-13(20)21)23-16(19-11)12-7-4-6-9-17-12/h4,6-7,9H,2-3,5,8,10H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | MCXFXYHCUACZLJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|