About 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid
3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid (PubChem CID 39165173) has the molecular formula C11H11N3O4S2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid |
| PubChem CID | 39165173 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid |
| SMILES | O=Cc1c(SCC(=O)NCCC(=O)O)nc2sccn12 |
| InChI | InChI=1S/C11H11N3O4S2/c15-5-7-10(13-11-14(7)3-4-19-11)20-6-8(16)12-2-1-9(17)18/h3-5H,1-2,6H2,(H,12,16)(H,17,18) |
| InChIKey | KCFGQYZATOVINY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid?
The IUPAC name of 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid (CID 39165173) is 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid.
What is the SMILES notation for 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid?
The canonical SMILES for 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid is O=Cc1c(SCC(=O)NCCC(=O)O)nc2sccn12.
What is the InChIKey of 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid?
The InChIKey is KCFGQYZATOVINY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O4S2/c15-5-7-10(13-11-14(7)3-4-19-11)20-6-8(16)12-2-1-9(17)18/h3-5H,1-2,6H2,(H,12,16)(H,17,18).
What are the key properties of 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid?
3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid has a molecular weight of 313.36 g/mol, XLogP of 0.89, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)sulfanylacetyl]amino]propanoic acid is sourced from PubChem (CID 39165173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).