C16H23N3S — CID 3917015
2-(3,4-dimethylphenyl)-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 3917015) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione.
| Compound Name | 2-(3,4-dimethylphenyl)-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 3917015 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-7-methyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | Cc1ccc(N2NC3(CCCC(C)C3)NC2=S)cc1C |
| InChI | InChI=1S/C16H23N3S/c1-11-5-4-8-16(10-11)17-15(20)19(18-16)14-7-6-12(2)13(3)9-14/h6-7,9,11,18H,4-5,8,10H2,1-3H3,(H,17,20) |
| InChIKey | PKMDZCSFYXIMES-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|