About N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine
N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine (PubChem CID 3917550) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine.
Molecular Properties
| Compound Name | N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine |
| PubChem CID | 3917550 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine |
| SMILES | CCN(Cc1cn2cccnc2n1)C1CCCCC1 |
| InChI | InChI=1S/C15H22N4/c1-2-18(14-7-4-3-5-8-14)11-13-12-19-10-6-9-16-15(19)17-13/h6,9-10,12,14H,2-5,7-8,11H2,1H3 |
| InChIKey | KZMUGPFWVXOUGC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine?
The IUPAC name of N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine (CID 3917550) is N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine.
What is the SMILES notation for N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine?
The canonical SMILES for N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine is CCN(Cc1cn2cccnc2n1)C1CCCCC1.
What is the InChIKey of N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine?
The InChIKey is KZMUGPFWVXOUGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-2-18(14-7-4-3-5-8-14)11-13-12-19-10-6-9-16-15(19)17-13/h6,9-10,12,14H,2-5,7-8,11H2,1H3.
What are the key properties of N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine?
N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine has a molecular weight of 258.37 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(imidazo[1,2-a]pyrimidin-2-ylmethyl)cyclohexanamine is sourced from PubChem (CID 3917550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).