C28H26Cl2N2O4 — CID 3917701
(4-butoxy-2-methylphenyl)-[2-(3,4-dichlorophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate (PubChem CID 3917701) has the molecular formula C28H26Cl2N2O4 and a molecular weight of 525.43 g/mol. Its IUPAC name is (4-butoxy-2-methylphenyl)-[2-(3,4-dichlorophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate.
| Compound Name | (4-butoxy-2-methylphenyl)-[2-(3,4-dichlorophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 3917701 |
| Molecular Formula | C28H26Cl2N2O4 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | (4-butoxy-2-methylphenyl)-[2-(3,4-dichlorophenyl)-4,5-dioxo-1-(pyridin-1-ium-3-ylmethyl)pyrrolidin-3-ylidene]methanolate |
| SMILES | CCCCOc1ccc(C([O-])=C2C(=O)C(=O)N(Cc3ccc[nH+]c3)C2c2ccc(Cl)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C28H26Cl2N2O4/c1-3-4-12-36-20-8-9-21(17(2)13-20)26(33)24-25(19-7-10-22(29)23(30)14-19)32(28(35)27(24)34)16-18-6-5-11-31-15-18/h5-11,13-15,25,33H,3-4,12,16H2,1-2H3 |
| InChIKey | POBAXTNDJDPFMN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|