C14H15ClN4O — CID 39178469
2-amino-N-[5-[(2-chlorophenyl)methylamino]-2-pyridinyl]acetamide (PubChem CID 39178469) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-amino-N-[5-[(2-chlorophenyl)methylamino]-2-pyridinyl]acetamide.
| Compound Name | 2-amino-N-[5-[(2-chlorophenyl)methylamino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 39178469 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-amino-N-[5-[(2-chlorophenyl)methylamino]-2-pyridinyl]acetamide |
| SMILES | NCC(=O)Nc1ccc(NCc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C14H15ClN4O/c15-12-4-2-1-3-10(12)8-17-11-5-6-13(18-9-11)19-14(20)7-16/h1-6,9,17H,7-8,16H2,(H,18,19,20) |
| InChIKey | MYGFUNINJFFEJW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |