C16H17N3O3S — CID 39179415
N-(4-cyclopentylsulfonylphenyl)pyrazine-2-carboxamide (PubChem CID 39179415) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)pyrazine-2-carboxamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 39179415 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C2CCCC2)cc1)c1cnccn1 |
| InChI | InChI=1S/C16H17N3O3S/c20-16(15-11-17-9-10-18-15)19-12-5-7-14(8-6-12)23(21,22)13-3-1-2-4-13/h5-11,13H,1-4H2,(H,19,20) |
| InChIKey | KQOZJUAGATXUGS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |