C23H21BrN4O3 — CID 3918115
N-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethylphenoxy)acetamide (PubChem CID 3918115) has the molecular formula C23H21BrN4O3 and a molecular weight of 481.35 g/mol. Its IUPAC name is N-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethylphenoxy)acetamide.
| Compound Name | N-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 3918115 |
| Molecular Formula | C23H21BrN4O3 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-[[5-[(3-bromophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-2-(3,5-dimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NN=Cc2cc(/N=N/c3cccc(Br)c3)ccc2O)c1 |
| InChI | InChI=1S/C23H21BrN4O3/c1-15-8-16(2)10-21(9-15)31-14-23(30)28-25-13-17-11-20(6-7-22(17)29)27-26-19-5-3-4-18(24)12-19/h3-13,29H,14H2,1-2H3,(H,28,30)/b25-13?,27-26+ |
| InChIKey | ZGRTVYTWKDBHQW-JVEAMIKXSA-N |
| XLogP | 5.72 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|