C19H21N3O3 — CID 39185656
(E)-N-[4-[(2-aminoacetyl)amino]-2-methylphenyl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 39185656) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (E)-N-[4-[(2-aminoacetyl)amino]-2-methylphenyl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(2-aminoacetyl)amino]-2-methylphenyl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 39185656 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (E)-N-[4-[(2-aminoacetyl)amino]-2-methylphenyl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(NC(=O)CN)cc2C)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-10-15(21-19(24)12-20)7-8-17(13)22-18(23)9-6-14-4-3-5-16(11-14)25-2/h3-11H,12,20H2,1-2H3,(H,21,24)(H,22,23)/b9-6+ |
| InChIKey | QTCIJPXLEXSNGZ-RMKNXTFCSA-N |
| XLogP | 2.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|