C18H13ClN4O2 — CID 39188157
2-chloro-N-[3-(pyridine-3-carbonylamino)phenyl]pyridine-4-carboxamide (PubChem CID 39188157) has the molecular formula C18H13ClN4O2 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-chloro-N-[3-(pyridine-3-carbonylamino)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[3-(pyridine-3-carbonylamino)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39188157 |
| Molecular Formula | C18H13ClN4O2 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-chloro-N-[3-(pyridine-3-carbonylamino)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccnc(Cl)c2)c1)c1cccnc1 |
| InChI | InChI=1S/C18H13ClN4O2/c19-16-9-12(6-8-21-16)17(24)22-14-4-1-5-15(10-14)23-18(25)13-3-2-7-20-11-13/h1-11H,(H,22,24)(H,23,25) |
| InChIKey | RGIALOIGHJTAFU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|