About 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine
4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 3918918) has the molecular formula C23H26FN3O2S
and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
| PubChem CID | 3918918 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | CCC(C=Nn1c(-c2cc(OC)ccc2OC)cs/c1=N\c1ccc(F)cc1)CC |
| InChI | InChI=1S/C23H26FN3O2S/c1-5-16(6-2)14-25-27-21(20-13-19(28-3)11-12-22(20)29-4)15-30-23(27)26-18-9-7-17(24)8-10-18/h7-16H,5-6H2,1-4H3/b25-14?,26-23- |
| InChIKey | ADBPHKCZGXLARO-JQMFECEZSA-N |
| XLogP | 5.88 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine?
The IUPAC name of 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine (CID 3918918) is 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine.
What is the SMILES notation for 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine?
The canonical SMILES for 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine is CCC(C=Nn1c(-c2cc(OC)ccc2OC)cs/c1=N\c1ccc(F)cc1)CC.
What is the InChIKey of 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine?
The InChIKey is ADBPHKCZGXLARO-JQMFECEZSA-N. The full InChI is InChI=1S/C23H26FN3O2S/c1-5-16(6-2)14-25-27-21(20-13-19(28-3)11-12-22(20)29-4)15-30-23(27)26-18-9-7-17(24)8-10-18/h7-16H,5-6H2,1-4H3/b25-14?,26-23-.
What are the key properties of 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine?
4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine has a molecular weight of 427.55 g/mol, XLogP of 5.88, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethoxyphenyl)-3-(2-ethylbutylideneamino)-N-(4-fluorophenyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 3918918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).