C17H16N2O3S — CID 39196340
(E)-3-[6-(4-methoxy-3-methylphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid (PubChem CID 39196340) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is (E)-3-[6-(4-methoxy-3-methylphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(4-methoxy-3-methylphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39196340 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (E)-3-[6-(4-methoxy-3-methylphenyl)-3-methylimidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2nc3scc(C)n3c2/C=C/C(=O)O)cc1C |
| InChI | InChI=1S/C17H16N2O3S/c1-10-8-12(4-6-14(10)22-3)16-13(5-7-15(20)21)19-11(2)9-23-17(19)18-16/h4-9H,1-3H3,(H,20,21)/b7-5+ |
| InChIKey | NBCDMKAGCMXRFW-FNORWQNLSA-N |
| XLogP | 3.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|