C13H10N4O3S — CID 39197925
2-ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 39197925) has the molecular formula C13H10N4O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 2-ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39197925 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | CCc1nn2c(C=O)c(-c3ccc([N+](=O)[O-])cc3)nc2s1 |
| InChI | InChI=1S/C13H10N4O3S/c1-2-11-15-16-10(7-18)12(14-13(16)21-11)8-3-5-9(6-4-8)17(19)20/h3-7H,2H2,1H3 |
| InChIKey | VNCAAJDZMUXEOX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|