C15H13N3OS — CID 39197951
2-cyclopropyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 39197951) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-cyclopropyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 2-cyclopropyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39197951 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-cyclopropyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | Cc1ccc(-c2nc3sc(C4CC4)nn3c2C=O)cc1 |
| InChI | InChI=1S/C15H13N3OS/c1-9-2-4-10(5-3-9)13-12(8-19)18-15(16-13)20-14(17-18)11-6-7-11/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | CLJXLYIEMQTIFR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|