C19H20FN3OS — CID 39198217
2-(2-cyclohexylethyl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 39198217) has the molecular formula C19H20FN3OS and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 2-(2-cyclohexylethyl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198217 |
| Molecular Formula | C19H20FN3OS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(2-cyclohexylethyl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(F)cc2)nc2sc(CCC3CCCCC3)nn12 |
| InChI | InChI=1S/C19H20FN3OS/c20-15-9-7-14(8-10-15)18-16(12-24)23-19(21-18)25-17(22-23)11-6-13-4-2-1-3-5-13/h7-10,12-13H,1-6,11H2 |
| InChIKey | SQHTXKBUXWUKDZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|