C20H14FN3OS — CID 39198538
3-(2,3-dihydro-1H-indol-5-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198538) has the molecular formula C20H14FN3OS and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198538 |
| Molecular Formula | C20H14FN3OS |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(F)cc2)nc2scc(-c3ccc4c(c3)CCN4)n12 |
| InChI | InChI=1S/C20H14FN3OS/c21-15-4-1-12(2-5-15)19-17(10-25)24-18(11-26-20(24)23-19)14-3-6-16-13(9-14)7-8-22-16/h1-6,9-11,22H,7-8H2 |
| InChIKey | JBFZSATTWHKZCH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|